C25H42NO+ — CID 6712614
(8R)-1-[(1R,4S,8aR)-4-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-4-ium-1-yl]-4,8,12-trimethyltrideca-4,6,11-trien-3-one (PubChem CID 6712614) has the molecular formula C25H42NO+ and a molecular weight of 372.62 g/mol. Its IUPAC name is (8R)-1-[(1R,4S,8aR)-4-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-4-ium-1-yl]-4,8,12-trimethyltrideca-4,6,11-trien-3-one.
| Compound Name | (8R)-1-[(1R,4S,8aR)-4-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-4-ium-1-yl]-4,8,12-trimethyltrideca-4,6,11-trien-3-one |
|---|---|
| PubChem CID | 6712614 |
| Molecular Formula | C25H42NO+ |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.33 |
| IUPAC Name | (8R)-1-[(1R,4S,8aR)-4-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-4-ium-1-yl]-4,8,12-trimethyltrideca-4,6,11-trien-3-one |
| SMILES | CC(C)=CCC[C@@H](C)C=CC=C(C)C(=O)CC[C@@H]1CC[N@+]2(C)CCCC[C@H]12 |
| InChI | InChI=1S/C25H42NO/c1-20(2)10-8-11-21(3)12-9-13-22(4)25(27)16-15-23-17-19-26(5)18-7-6-14-24(23)26/h9-10,12-13,21,23-24H,6-8,11,14-19H2,1-5H3/q+1/t21-,23-,24-,26+/m1/s1 |
| InChIKey | XVHGEQZLPUATNX-APJZGJRSSA-N |
| XLogP | 6.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|