About [3-(1,1-difluoropropan-2-yl)piperidin-4-yl]methanol
[3-(1,1-difluoropropan-2-yl)piperidin-4-yl]methanol (PubChem CID 67126485) has the molecular formula C9H17F2NO
and a molecular weight of 193.24 g/mol. Its IUPAC name is [3-(1,1-difluoropropan-2-yl)piperidin-4-yl]methanol.
Molecular Properties
| Compound Name | [3-(1,1-difluoropropan-2-yl)piperidin-4-yl]methanol |
| PubChem CID | 67126485 |
| Molecular Formula | C9H17F2NO |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | [3-(1,1-difluoropropan-2-yl)piperidin-4-yl]methanol |
| SMILES | CC(C(F)F)C1CNCCC1CO |
| InChI | InChI=1S/C9H17F2NO/c1-6(9(10)11)8-4-12-3-2-7(8)5-13/h6-9,12-13H,2-5H2,1H3 |
| InChIKey | JKNIZDZBLMSGPH-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3-(1,1-difluoropropan-2-yl)piperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,1-difluoropropan-2-yl)piperidin-4-yl]methanol?
The IUPAC name of [3-(1,1-difluoropropan-2-yl)piperidin-4-yl]methanol (CID 67126485) is [3-(1,1-difluoropropan-2-yl)piperidin-4-yl]methanol.
What is the SMILES notation for [3-(1,1-difluoropropan-2-yl)piperidin-4-yl]methanol?
The canonical SMILES for [3-(1,1-difluoropropan-2-yl)piperidin-4-yl]methanol is CC(C(F)F)C1CNCCC1CO.
What is the InChIKey of [3-(1,1-difluoropropan-2-yl)piperidin-4-yl]methanol?
The InChIKey is JKNIZDZBLMSGPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F2NO/c1-6(9(10)11)8-4-12-3-2-7(8)5-13/h6-9,12-13H,2-5H2,1H3.
What are the key properties of [3-(1,1-difluoropropan-2-yl)piperidin-4-yl]methanol?
[3-(1,1-difluoropropan-2-yl)piperidin-4-yl]methanol has a molecular weight of 193.24 g/mol, XLogP of 1.11, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,1-difluoropropan-2-yl)piperidin-4-yl]methanol is sourced from PubChem (CID 67126485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).