About 5-chloro-6-[[1-(1,3-difluoropropan-2-yl)pyrrolidin-3-yl]methoxy]pyridine-3-sulfonamide
5-chloro-6-[[1-(1,3-difluoropropan-2-yl)pyrrolidin-3-yl]methoxy]pyridine-3-sulfonamide (PubChem CID 67126533) has the molecular formula C13H18ClF2N3O3S
and a molecular weight of 369.82 g/mol. Its IUPAC name is 5-chloro-6-[[1-(1,3-difluoropropan-2-yl)pyrrolidin-3-yl]methoxy]pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 5-chloro-6-[[1-(1,3-difluoropropan-2-yl)pyrrolidin-3-yl]methoxy]pyridine-3-sulfonamide |
| PubChem CID | 67126533 |
| Molecular Formula | C13H18ClF2N3O3S |
| Molecular Weight | 369.82 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 5-chloro-6-[[1-(1,3-difluoropropan-2-yl)pyrrolidin-3-yl]methoxy]pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1cnc(OCC2CCN(C(CF)CF)C2)c(Cl)c1 |
| InChI | InChI=1S/C13H18ClF2N3O3S/c14-12-3-11(23(17,20)21)6-18-13(12)22-8-9-1-2-19(7-9)10(4-15)5-16/h3,6,9-10H,1-2,4-5,7-8H2,(H2,17,20,21) |
| InChIKey | XMKLFMLZWIARJV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.82 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-chloro-6-[[1-(1,3-difluoropropan-2-yl)pyrrolidin-3-yl]methoxy]pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-6-[[1-(1,3-difluoropropan-2-yl)pyrrolidin-3-yl]methoxy]pyridine-3-sulfonamide?
The IUPAC name of 5-chloro-6-[[1-(1,3-difluoropropan-2-yl)pyrrolidin-3-yl]methoxy]pyridine-3-sulfonamide (CID 67126533) is 5-chloro-6-[[1-(1,3-difluoropropan-2-yl)pyrrolidin-3-yl]methoxy]pyridine-3-sulfonamide.
What is the SMILES notation for 5-chloro-6-[[1-(1,3-difluoropropan-2-yl)pyrrolidin-3-yl]methoxy]pyridine-3-sulfonamide?
The canonical SMILES for 5-chloro-6-[[1-(1,3-difluoropropan-2-yl)pyrrolidin-3-yl]methoxy]pyridine-3-sulfonamide is NS(=O)(=O)c1cnc(OCC2CCN(C(CF)CF)C2)c(Cl)c1.
What is the InChIKey of 5-chloro-6-[[1-(1,3-difluoropropan-2-yl)pyrrolidin-3-yl]methoxy]pyridine-3-sulfonamide?
The InChIKey is XMKLFMLZWIARJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClF2N3O3S/c14-12-3-11(23(17,20)21)6-18-13(12)22-8-9-1-2-19(7-9)10(4-15)5-16/h3,6,9-10H,1-2,4-5,7-8H2,(H2,17,20,21).
What are the key properties of 5-chloro-6-[[1-(1,3-difluoropropan-2-yl)pyrrolidin-3-yl]methoxy]pyridine-3-sulfonamide?
5-chloro-6-[[1-(1,3-difluoropropan-2-yl)pyrrolidin-3-yl]methoxy]pyridine-3-sulfonamide has a molecular weight of 369.82 g/mol, XLogP of 1.39, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-6-[[1-(1,3-difluoropropan-2-yl)pyrrolidin-3-yl]methoxy]pyridine-3-sulfonamide is sourced from PubChem (CID 67126533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).