About 4-(4-anilinophenyl)-2,3-bis(4-methoxyphenyl)-N-phenylaniline
4-(4-anilinophenyl)-2,3-bis(4-methoxyphenyl)-N-phenylaniline (PubChem CID 67126877) has the molecular formula C38H32N2O2
and a molecular weight of 548.69 g/mol. Its IUPAC name is 4-(4-anilinophenyl)-2,3-bis(4-methoxyphenyl)-N-phenylaniline.
Molecular Properties
| Compound Name | 4-(4-anilinophenyl)-2,3-bis(4-methoxyphenyl)-N-phenylaniline |
| PubChem CID | 67126877 |
| Molecular Formula | C38H32N2O2 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | 4-(4-anilinophenyl)-2,3-bis(4-methoxyphenyl)-N-phenylaniline |
| SMILES | COc1ccc(-c2c(Nc3ccccc3)ccc(-c3ccc(Nc4ccccc4)cc3)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H32N2O2/c1-41-33-21-15-28(16-22-33)37-35(27-13-19-32(20-14-27)39-30-9-5-3-6-10-30)25-26-36(40-31-11-7-4-8-12-31)38(37)29-17-23-34(42-2)24-18-29/h3-26,39-40H,1-2H3 |
| InChIKey | BKDXHBNBTJUTBB-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-anilinophenyl)-2,3-bis(4-methoxyphenyl)-N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-anilinophenyl)-2,3-bis(4-methoxyphenyl)-N-phenylaniline?
The IUPAC name of 4-(4-anilinophenyl)-2,3-bis(4-methoxyphenyl)-N-phenylaniline (CID 67126877) is 4-(4-anilinophenyl)-2,3-bis(4-methoxyphenyl)-N-phenylaniline.
What is the SMILES notation for 4-(4-anilinophenyl)-2,3-bis(4-methoxyphenyl)-N-phenylaniline?
The canonical SMILES for 4-(4-anilinophenyl)-2,3-bis(4-methoxyphenyl)-N-phenylaniline is COc1ccc(-c2c(Nc3ccccc3)ccc(-c3ccc(Nc4ccccc4)cc3)c2-c2ccc(OC)cc2)cc1.
What is the InChIKey of 4-(4-anilinophenyl)-2,3-bis(4-methoxyphenyl)-N-phenylaniline?
The InChIKey is BKDXHBNBTJUTBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H32N2O2/c1-41-33-21-15-28(16-22-33)37-35(27-13-19-32(20-14-27)39-30-9-5-3-6-10-30)25-26-36(40-31-11-7-4-8-12-31)38(37)29-17-23-34(42-2)24-18-29/h3-26,39-40H,1-2H3.
What are the key properties of 4-(4-anilinophenyl)-2,3-bis(4-methoxyphenyl)-N-phenylaniline?
4-(4-anilinophenyl)-2,3-bis(4-methoxyphenyl)-N-phenylaniline has a molecular weight of 548.69 g/mol, XLogP of 10.19, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-anilinophenyl)-2,3-bis(4-methoxyphenyl)-N-phenylaniline is sourced from PubChem (CID 67126877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).