C15H16N4O4 — CID 6712693
ethyl (1S,2R,6R,9R)-7-oxo-9-phenyl-10-oxa-3,4,5,8-tetrazatricyclo[6.3.0.02,6]undec-3-ene-6-carboxylate (PubChem CID 6712693) has the molecular formula C15H16N4O4 and a molecular weight of 316.32 g/mol. Its IUPAC name is ethyl (1S,2R,6R,9R)-7-oxo-9-phenyl-10-oxa-3,4,5,8-tetrazatricyclo[6.3.0.02,6]undec-3-ene-6-carboxylate.
| Compound Name | ethyl (1S,2R,6R,9R)-7-oxo-9-phenyl-10-oxa-3,4,5,8-tetrazatricyclo[6.3.0.02,6]undec-3-ene-6-carboxylate |
|---|---|
| PubChem CID | 6712693 |
| Molecular Formula | C15H16N4O4 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | ethyl (1S,2R,6R,9R)-7-oxo-9-phenyl-10-oxa-3,4,5,8-tetrazatricyclo[6.3.0.02,6]undec-3-ene-6-carboxylate |
| SMILES | CCOC(=O)[C@@]12NN=N[C@@H]1[C@H]1CO[C@H](c3ccccc3)N1C2=O |
| InChI | InChI=1S/C15H16N4O4/c1-2-22-14(21)15-11(16-18-17-15)10-8-23-12(19(10)13(15)20)9-6-4-3-5-7-9/h3-7,10-12H,2,8H2,1H3,(H,16,17)/t10-,11-,12-,15-/m1/s1 |
| InChIKey | VPVGVICVNTYXMQ-RTWAVKEYSA-N |
| XLogP | 0.57 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|