About 1-butylpiperidine;trifluoromethanesulfonamide
1-butylpiperidine;trifluoromethanesulfonamide (PubChem CID 67127201) has the molecular formula C10H21F3N2O2S
and a molecular weight of 290.35 g/mol. Its IUPAC name is 1-butylpiperidine;trifluoromethanesulfonamide.
Molecular Properties
| Compound Name | 1-butylpiperidine;trifluoromethanesulfonamide |
| PubChem CID | 67127201 |
| Molecular Formula | C10H21F3N2O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 1-butylpiperidine;trifluoromethanesulfonamide |
| SMILES | CCCCN1CCCCC1.NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H19N.CH2F3NO2S/c1-2-3-7-10-8-5-4-6-9-10;2-1(3,4)8(5,6)7/h2-9H2,1H3;(H2,5,6,7) |
| InChIKey | NZDWIVLGCGPIQZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butylpiperidine;trifluoromethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylpiperidine;trifluoromethanesulfonamide?
The IUPAC name of 1-butylpiperidine;trifluoromethanesulfonamide (CID 67127201) is 1-butylpiperidine;trifluoromethanesulfonamide.
What is the SMILES notation for 1-butylpiperidine;trifluoromethanesulfonamide?
The canonical SMILES for 1-butylpiperidine;trifluoromethanesulfonamide is CCCCN1CCCCC1.NS(=O)(=O)C(F)(F)F.
What is the InChIKey of 1-butylpiperidine;trifluoromethanesulfonamide?
The InChIKey is NZDWIVLGCGPIQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.CH2F3NO2S/c1-2-3-7-10-8-5-4-6-9-10;2-1(3,4)8(5,6)7/h2-9H2,1H3;(H2,5,6,7).
What are the key properties of 1-butylpiperidine;trifluoromethanesulfonamide?
1-butylpiperidine;trifluoromethanesulfonamide has a molecular weight of 290.35 g/mol, XLogP of 2.07, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylpiperidine;trifluoromethanesulfonamide is sourced from PubChem (CID 67127201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).