C35H65Cl2NO3 — CID 67127245
2-(4-chloro-2-methylphenoxy)propanoic acid;methyl(trioctyl)azanium;chloride (PubChem CID 67127245) has the molecular formula C35H65Cl2NO3 and a molecular weight of 618.82 g/mol. Its IUPAC name is 2-(4-chloro-2-methylphenoxy)propanoic acid;methyl(trioctyl)azanium;chloride.
| Compound Name | 2-(4-chloro-2-methylphenoxy)propanoic acid;methyl(trioctyl)azanium;chloride |
|---|---|
| PubChem CID | 67127245 |
| Molecular Formula | C35H65Cl2NO3 |
| Molecular Weight | 618.82 g/mol |
| Exact Mass | 617.43 |
| IUPAC Name | 2-(4-chloro-2-methylphenoxy)propanoic acid;methyl(trioctyl)azanium;chloride |
| SMILES | CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC.Cc1cc(Cl)ccc1OC(C)C(=O)O.[Cl-] |
| InChI | InChI=1S/C25H54N.C10H11ClO3.ClH/c1-5-8-11-14-17-20-23-26(4,24-21-18-15-12-9-6-2)25-22-19-16-13-10-7-3;1-6-5-8(11)3-4-9(6)14-7(2)10(12)13;/h5-25H2,1-4H3;3-5,7H,1-2H3,(H,12,13);1H/q+1;;/p-1 |
| InChIKey | IQEWESRFQJQZGB-UHFFFAOYSA-M |
| XLogP | 8.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.82 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|