C6H12N5O2PS2 — CID 67127248
6-[[methoxy(methylsulfanyl)phosphoryl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 67127248) has the molecular formula C6H12N5O2PS2 and a molecular weight of 281.30 g/mol. Its IUPAC name is 6-[[methoxy(methylsulfanyl)phosphoryl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[[methoxy(methylsulfanyl)phosphoryl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 67127248 |
| Molecular Formula | C6H12N5O2PS2 |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 6-[[methoxy(methylsulfanyl)phosphoryl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | COP(=O)(SC)SCc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C6H12N5O2PS2/c1-13-14(12,15-2)16-3-4-9-5(7)11-6(8)10-4/h3H2,1-2H3,(H4,7,8,9,10,11) |
| InChIKey | HNXMSTICZJEHIW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 117.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|