C18H24Cl2N2O — CID 6712729
2-(3,4-Dichloro-phenyl)-N-(2-pyrrolidin-1-yl-cyclohexyl)-acetamide (PubChem CID 6712729) has the molecular formula C18H24Cl2N2O and a molecular weight of 355.30 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]acetamide.
| Compound Name | 2-(3,4-Dichloro-phenyl)-N-(2-pyrrolidin-1-yl-cyclohexyl)-acetamide |
|---|---|
| PubChem CID | 6712729 |
| Molecular Formula | C18H24Cl2N2O |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-[(1R,2S)-2-pyrrolidin-1-ylcyclohexyl]acetamide |
| SMILES | C1CC[C@@H]([C@@H](C1)NC(=O)CC2=CC(=C(C=C2)Cl)Cl)N3CCCC3 |
| InChI | InChI=1S/C18H24Cl2N2O/c19-14-8-7-13(11-15(14)20)12-18(23)21-16-5-1-2-6-17(16)22-9-3-4-10-22/h7-8,11,16-17H,1-6,9-10,12H2,(H,21,23)/t16-,17+/m1/s1 |
| InChIKey | KWSRPMWFUYDWFC-SJORKVTESA-N |
| XLogP | 4.30 |
| TPSA | 32.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | 400 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |