About N-(2-ethoxypropyl)-3,3-diphenylpropan-1-amine
N-(2-ethoxypropyl)-3,3-diphenylpropan-1-amine (PubChem CID 67127545) has the molecular formula C20H27NO
and a molecular weight of 297.44 g/mol. Its IUPAC name is N-(2-ethoxypropyl)-3,3-diphenylpropan-1-amine.
Molecular Properties
| Compound Name | N-(2-ethoxypropyl)-3,3-diphenylpropan-1-amine |
| PubChem CID | 67127545 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | N-(2-ethoxypropyl)-3,3-diphenylpropan-1-amine |
| SMILES | CCOC(C)CNCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H27NO/c1-3-22-17(2)16-21-15-14-20(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-13,17,20-21H,3,14-16H2,1-2H3 |
| InChIKey | DKOXCZRUECYLHG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-ethoxypropyl)-3,3-diphenylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethoxypropyl)-3,3-diphenylpropan-1-amine?
The IUPAC name of N-(2-ethoxypropyl)-3,3-diphenylpropan-1-amine (CID 67127545) is N-(2-ethoxypropyl)-3,3-diphenylpropan-1-amine.
What is the SMILES notation for N-(2-ethoxypropyl)-3,3-diphenylpropan-1-amine?
The canonical SMILES for N-(2-ethoxypropyl)-3,3-diphenylpropan-1-amine is CCOC(C)CNCCC(c1ccccc1)c1ccccc1.
What is the InChIKey of N-(2-ethoxypropyl)-3,3-diphenylpropan-1-amine?
The InChIKey is DKOXCZRUECYLHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27NO/c1-3-22-17(2)16-21-15-14-20(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-13,17,20-21H,3,14-16H2,1-2H3.
What are the key properties of N-(2-ethoxypropyl)-3,3-diphenylpropan-1-amine?
N-(2-ethoxypropyl)-3,3-diphenylpropan-1-amine has a molecular weight of 297.44 g/mol, XLogP of 4.22, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethoxypropyl)-3,3-diphenylpropan-1-amine is sourced from PubChem (CID 67127545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).