C25H29Cl2NO7 — CID 6712782
(1R,6R,13S,15S,19R)-7,19-dichloro-18,18-dimethyl-7-(phenylmethoxymethyl)-5,9,12-trioxa-3-azatetracyclo[13.2.1.13,6.01,13]nonadecane-2,4,8-trione (PubChem CID 6712782) has the molecular formula C25H29Cl2NO7 and a molecular weight of 526.41 g/mol. Its IUPAC name is (1R,6R,13S,15S,19R)-7,19-dichloro-18,18-dimethyl-7-(phenylmethoxymethyl)-5,9,12-trioxa-3-azatetracyclo[13.2.1.13,6.01,13]nonadecane-2,4,8-trione.
| Compound Name | (1R,6R,13S,15S,19R)-7,19-dichloro-18,18-dimethyl-7-(phenylmethoxymethyl)-5,9,12-trioxa-3-azatetracyclo[13.2.1.13,6.01,13]nonadecane-2,4,8-trione |
|---|---|
| PubChem CID | 6712782 |
| Molecular Formula | C25H29Cl2NO7 |
| Molecular Weight | 526.41 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | (1R,6R,13S,15S,19R)-7,19-dichloro-18,18-dimethyl-7-(phenylmethoxymethyl)-5,9,12-trioxa-3-azatetracyclo[13.2.1.13,6.01,13]nonadecane-2,4,8-trione |
| SMILES | CC1(C)[C@H]2CC[C@@]13C(=O)N1C(=O)O[C@@H]([C@H]1Cl)C(Cl)(COCc1ccccc1)C(=O)OCCO[C@H]3C2 |
| InChI | InChI=1S/C25H29Cl2NO7/c1-23(2)16-8-9-24(23)17(12-16)33-10-11-34-21(30)25(27,14-32-13-15-6-4-3-5-7-15)18-19(26)28(20(24)29)22(31)35-18/h3-7,16-19H,8-14H2,1-2H3/t16-,17-,18-,19-,24+,25?/m0/s1 |
| InChIKey | KTSSTDDKRACMDH-NUSOTDOXSA-N |
| XLogP | 3.86 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|