About 1-(cyclohexylmethoxy)-2,2,2-trifluoroethanesulfonamide
1-(cyclohexylmethoxy)-2,2,2-trifluoroethanesulfonamide (PubChem CID 67127821) has the molecular formula C9H16F3NO3S
and a molecular weight of 275.29 g/mol. Its IUPAC name is 1-(cyclohexylmethoxy)-2,2,2-trifluoroethanesulfonamide.
Molecular Properties
| Compound Name | 1-(cyclohexylmethoxy)-2,2,2-trifluoroethanesulfonamide |
| PubChem CID | 67127821 |
| Molecular Formula | C9H16F3NO3S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 1-(cyclohexylmethoxy)-2,2,2-trifluoroethanesulfonamide |
| SMILES | NS(=O)(=O)C(OCC1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C9H16F3NO3S/c10-9(11,12)8(17(13,14)15)16-6-7-4-2-1-3-5-7/h7-8H,1-6H2,(H2,13,14,15) |
| InChIKey | TZCBTXFZDBWBDN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(cyclohexylmethoxy)-2,2,2-trifluoroethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexylmethoxy)-2,2,2-trifluoroethanesulfonamide?
The IUPAC name of 1-(cyclohexylmethoxy)-2,2,2-trifluoroethanesulfonamide (CID 67127821) is 1-(cyclohexylmethoxy)-2,2,2-trifluoroethanesulfonamide.
What is the SMILES notation for 1-(cyclohexylmethoxy)-2,2,2-trifluoroethanesulfonamide?
The canonical SMILES for 1-(cyclohexylmethoxy)-2,2,2-trifluoroethanesulfonamide is NS(=O)(=O)C(OCC1CCCCC1)C(F)(F)F.
What is the InChIKey of 1-(cyclohexylmethoxy)-2,2,2-trifluoroethanesulfonamide?
The InChIKey is TZCBTXFZDBWBDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO3S/c10-9(11,12)8(17(13,14)15)16-6-7-4-2-1-3-5-7/h7-8H,1-6H2,(H2,13,14,15).
What are the key properties of 1-(cyclohexylmethoxy)-2,2,2-trifluoroethanesulfonamide?
1-(cyclohexylmethoxy)-2,2,2-trifluoroethanesulfonamide has a molecular weight of 275.29 g/mol, XLogP of 1.76, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexylmethoxy)-2,2,2-trifluoroethanesulfonamide is sourced from PubChem (CID 67127821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).