About spiro[7aH-1-benzofuran-2,4'-azepane]
spiro[7aH-1-benzofuran-2,4'-azepane] (PubChem CID 67127825) has the molecular formula C13H17NO
and a molecular weight of 203.28 g/mol. Its IUPAC name is spiro[7aH-1-benzofuran-2,4'-azepane].
Molecular Properties
| Compound Name | spiro[7aH-1-benzofuran-2,4'-azepane] |
| PubChem CID | 67127825 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | spiro[7aH-1-benzofuran-2,4'-azepane] |
| SMILES | C1=CC2=CC3(CCCNCC3)OC2C=C1 |
| InChI | InChI=1S/C13H17NO/c1-2-5-12-11(4-1)10-13(15-12)6-3-8-14-9-7-13/h1-2,4-5,10,12,14H,3,6-9H2 |
| InChIKey | MZUUMOVIKOICII-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[7aH-1-benzofuran-2,4'-azepane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[7aH-1-benzofuran-2,4'-azepane]?
The IUPAC name of spiro[7aH-1-benzofuran-2,4'-azepane] (CID 67127825) is spiro[7aH-1-benzofuran-2,4'-azepane].
What is the SMILES notation for spiro[7aH-1-benzofuran-2,4'-azepane]?
The canonical SMILES for spiro[7aH-1-benzofuran-2,4'-azepane] is C1=CC2=CC3(CCCNCC3)OC2C=C1.
What is the InChIKey of spiro[7aH-1-benzofuran-2,4'-azepane]?
The InChIKey is MZUUMOVIKOICII-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO/c1-2-5-12-11(4-1)10-13(15-12)6-3-8-14-9-7-13/h1-2,4-5,10,12,14H,3,6-9H2.
What are the key properties of spiro[7aH-1-benzofuran-2,4'-azepane]?
spiro[7aH-1-benzofuran-2,4'-azepane] has a molecular weight of 203.28 g/mol, XLogP of 1.95, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[7aH-1-benzofuran-2,4'-azepane] is sourced from PubChem (CID 67127825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).