About butan-1-amine;pyrrole-2,5-dione
butan-1-amine;pyrrole-2,5-dione (PubChem CID 67128016) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is butan-1-amine;pyrrole-2,5-dione.
Molecular Properties
| Compound Name | butan-1-amine;pyrrole-2,5-dione |
| PubChem CID | 67128016 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | butan-1-amine;pyrrole-2,5-dione |
| SMILES | CCCCN.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C4H3NO2.C4H11N/c6-3-1-2-4(7)5-3;1-2-3-4-5/h1-2H,(H,5,6,7);2-5H2,1H3 |
| InChIKey | ABMGCEHRAMSTIL-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze butan-1-amine;pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-amine;pyrrole-2,5-dione?
The IUPAC name of butan-1-amine;pyrrole-2,5-dione (CID 67128016) is butan-1-amine;pyrrole-2,5-dione.
What is the SMILES notation for butan-1-amine;pyrrole-2,5-dione?
The canonical SMILES for butan-1-amine;pyrrole-2,5-dione is CCCCN.O=C1C=CC(=O)N1.
What is the InChIKey of butan-1-amine;pyrrole-2,5-dione?
The InChIKey is ABMGCEHRAMSTIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3NO2.C4H11N/c6-3-1-2-4(7)5-3;1-2-3-4-5/h1-2H,(H,5,6,7);2-5H2,1H3.
What are the key properties of butan-1-amine;pyrrole-2,5-dione?
butan-1-amine;pyrrole-2,5-dione has a molecular weight of 170.21 g/mol, XLogP of -0.06, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-amine;pyrrole-2,5-dione is sourced from PubChem (CID 67128016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).