C26H29NO — CID 6712808
(2S,5S)-2,5-dimethyl-2,5-diphenyl-1-(1-phenylethoxy)pyrrolidine (PubChem CID 6712808) has the molecular formula C26H29NO and a molecular weight of 371.52 g/mol. Its IUPAC name is (2S,5S)-2,5-dimethyl-2,5-diphenyl-1-(1-phenylethoxy)pyrrolidine.
| Compound Name | (2S,5S)-2,5-dimethyl-2,5-diphenyl-1-(1-phenylethoxy)pyrrolidine |
|---|---|
| PubChem CID | 6712808 |
| Molecular Formula | C26H29NO |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | (2S,5S)-2,5-dimethyl-2,5-diphenyl-1-(1-phenylethoxy)pyrrolidine |
| SMILES | CC(ON1[C@](C)(c2ccccc2)CC[C@@]1(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H29NO/c1-21(22-13-7-4-8-14-22)28-27-25(2,23-15-9-5-10-16-23)19-20-26(27,3)24-17-11-6-12-18-24/h4-18,21H,19-20H2,1-3H3/t21?,25-,26-/m0/s1 |
| InChIKey | INQXAJZMLNZJKF-RMFXBNNXSA-N |
| XLogP | 6.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |