2-[5-(2-methyl-1,3-dioxolan-2-yl)-1,3-oxazol-2-yl]acetic acid

C9H11NO5 — CID 67128431

IUPAC2-[5-(2-methyl-1,3-dioxolan-2-yl)-1,3-oxazol-2-yl]acetic acid
SMILESCC1(c2cnc(CC(=O)O)o2)OCCO1
InChIInChI=1S/C9H11NO5/c1-9(13-2-3-14-9)6-5-10-7(15-6)4-8(11)12/h5H,2-4H2,1H3,(H,11,12)
InChIKeyIWAJSPSEPREDQP-UHFFFAOYSA-N
MW213.19 g/mol
LogP0.52
Rot. Bonds3

About 2-[5-(2-methyl-1,3-dioxolan-2-yl)-1,3-oxazol-2-yl]acetic acid

2-[5-(2-methyl-1,3-dioxolan-2-yl)-1,3-oxazol-2-yl]acetic acid (PubChem CID 67128431) has the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. Its IUPAC name is 2-[5-(2-methyl-1,3-dioxolan-2-yl)-1,3-oxazol-2-yl]acetic acid.

Molecular Properties

Compound Name2-[5-(2-methyl-1,3-dioxolan-2-yl)-1,3-oxazol-2-yl]acetic acid
PubChem CID67128431
Molecular FormulaC9H11NO5
Molecular Weight213.19 g/mol
Exact Mass213.06
IUPAC Name2-[5-(2-methyl-1,3-dioxolan-2-yl)-1,3-oxazol-2-yl]acetic acid
SMILESCC1(c2cnc(CC(=O)O)o2)OCCO1
InChIInChI=1S/C9H11NO5/c1-9(13-2-3-14-9)6-5-10-7(15-6)4-8(11)12/h5H,2-4H2,1H3,(H,11,12)
InChIKeyIWAJSPSEPREDQP-UHFFFAOYSA-N
XLogP0.52
TPSA81.79 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.19
LogP ≤ 50.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[5-(2-methyl-1,3-dioxolan-2-yl)-1,3-oxazol-2-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-(2-methyl-1,3-dioxolan-2-yl)-1,3-oxazol-2-yl]acetic acid?
The IUPAC name of 2-[5-(2-methyl-1,3-dioxolan-2-yl)-1,3-oxazol-2-yl]acetic acid (CID 67128431) is 2-[5-(2-methyl-1,3-dioxolan-2-yl)-1,3-oxazol-2-yl]acetic acid.
What is the SMILES notation for 2-[5-(2-methyl-1,3-dioxolan-2-yl)-1,3-oxazol-2-yl]acetic acid?
The canonical SMILES for 2-[5-(2-methyl-1,3-dioxolan-2-yl)-1,3-oxazol-2-yl]acetic acid is CC1(c2cnc(CC(=O)O)o2)OCCO1.
What is the InChIKey of 2-[5-(2-methyl-1,3-dioxolan-2-yl)-1,3-oxazol-2-yl]acetic acid?
The InChIKey is IWAJSPSEPREDQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO5/c1-9(13-2-3-14-9)6-5-10-7(15-6)4-8(11)12/h5H,2-4H2,1H3,(H,11,12).
What are the key properties of 2-[5-(2-methyl-1,3-dioxolan-2-yl)-1,3-oxazol-2-yl]acetic acid?
2-[5-(2-methyl-1,3-dioxolan-2-yl)-1,3-oxazol-2-yl]acetic acid has a molecular weight of 213.19 g/mol, XLogP of 0.52, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2-methyl-1,3-dioxolan-2-yl)-1,3-oxazol-2-yl]acetic acid is sourced from PubChem (CID 67128431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).