C31H36N3O9P — CID 67128459
aminophosphonous acid;1-[(2S,4S,5R)-2-[bis(2-methoxyphenyl)-phenylmethyl]-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 67128459) has the molecular formula C31H36N3O9P and a molecular weight of 625.62 g/mol. Its IUPAC name is aminophosphonous acid;1-[(2S,4S,5R)-2-[bis(2-methoxyphenyl)-phenylmethyl]-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | aminophosphonous acid;1-[(2S,4S,5R)-2-[bis(2-methoxyphenyl)-phenylmethyl]-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67128459 |
| Molecular Formula | C31H36N3O9P |
| Molecular Weight | 625.62 g/mol |
| Exact Mass | 625.22 |
| IUPAC Name | aminophosphonous acid;1-[(2S,4S,5R)-2-[bis(2-methoxyphenyl)-phenylmethyl]-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | COc1ccccc1C(c1ccccc1)(c1ccccc1OC)[C@]1(n2cc(C)c(=O)[nH]c2=O)C[C@H](O)[C@@H](CO)O1.NP(O)O |
| InChI | InChI=1S/C31H32N2O7.H4NO2P/c1-20-18-33(29(37)32-28(20)36)30(17-24(35)27(19-34)40-30)31(21-11-5-4-6-12-21,22-13-7-9-15-25(22)38-2)23-14-8-10-16-26(23)39-3;1-4(2)3/h4-16,18,24,27,34-35H,17,19H2,1-3H3,(H,32,36,37);2-3H,1H2/t24-,27+,30-;/m0./s1 |
| InChIKey | MDXYXSQDWMVHQG-WOXRVKNMSA-N |
| XLogP | 1.85 |
| TPSA | 189.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.62 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|