About methyl 2-(5,5-difluorohexyl)-1,3-oxazole-4-carboxylate
methyl 2-(5,5-difluorohexyl)-1,3-oxazole-4-carboxylate (PubChem CID 67128576) has the molecular formula C11H15F2NO3
and a molecular weight of 247.24 g/mol. Its IUPAC name is methyl 2-(5,5-difluorohexyl)-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(5,5-difluorohexyl)-1,3-oxazole-4-carboxylate |
| PubChem CID | 67128576 |
| Molecular Formula | C11H15F2NO3 |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | methyl 2-(5,5-difluorohexyl)-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)c1coc(CCCCC(C)(F)F)n1 |
| InChI | InChI=1S/C11H15F2NO3/c1-11(12,13)6-4-3-5-9-14-8(7-17-9)10(15)16-2/h7H,3-6H2,1-2H3 |
| InChIKey | RNQAMOHONUVRPH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(5,5-difluorohexyl)-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(5,5-difluorohexyl)-1,3-oxazole-4-carboxylate?
The IUPAC name of methyl 2-(5,5-difluorohexyl)-1,3-oxazole-4-carboxylate (CID 67128576) is methyl 2-(5,5-difluorohexyl)-1,3-oxazole-4-carboxylate.
What is the SMILES notation for methyl 2-(5,5-difluorohexyl)-1,3-oxazole-4-carboxylate?
The canonical SMILES for methyl 2-(5,5-difluorohexyl)-1,3-oxazole-4-carboxylate is COC(=O)c1coc(CCCCC(C)(F)F)n1.
What is the InChIKey of methyl 2-(5,5-difluorohexyl)-1,3-oxazole-4-carboxylate?
The InChIKey is RNQAMOHONUVRPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F2NO3/c1-11(12,13)6-4-3-5-9-14-8(7-17-9)10(15)16-2/h7H,3-6H2,1-2H3.
What are the key properties of methyl 2-(5,5-difluorohexyl)-1,3-oxazole-4-carboxylate?
methyl 2-(5,5-difluorohexyl)-1,3-oxazole-4-carboxylate has a molecular weight of 247.24 g/mol, XLogP of 2.83, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(5,5-difluorohexyl)-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 67128576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).