About cis-(1S,2S)-2-fluorocyclopropane-1-carboxamide
cis-(1S,2S)-2-fluorocyclopropane-1-carboxamide (PubChem CID 67128653) has the molecular formula C4H6FNO
and a molecular weight of 103.10 g/mol. Its IUPAC name is cis-(1S,2S)-2-fluorocyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | cis-(1S,2S)-2-fluorocyclopropane-1-carboxamide |
| PubChem CID | 67128653 |
| Molecular Formula | C4H6FNO |
| Molecular Weight | 103.10 g/mol |
| Exact Mass | 103.04 |
| IUPAC Name | cis-(1S,2S)-2-fluorocyclopropane-1-carboxamide |
| SMILES | NC(=O)[C@@H]1C[C@@H]1F |
| InChI | InChI=1S/C4H6FNO/c5-3-1-2(3)4(6)7/h2-3H,1H2,(H2,6,7)/t2-,3+/m1/s1 |
| InChIKey | PHZKRDKMJHXGBR-GBXIJSLDSA-N |
| XLogP | -0.17 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.10 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cis-(1S,2S)-2-fluorocyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2S)-2-fluorocyclopropane-1-carboxamide?
The IUPAC name of cis-(1S,2S)-2-fluorocyclopropane-1-carboxamide (CID 67128653) is cis-(1S,2S)-2-fluorocyclopropane-1-carboxamide.
What is the SMILES notation for cis-(1S,2S)-2-fluorocyclopropane-1-carboxamide?
The canonical SMILES for cis-(1S,2S)-2-fluorocyclopropane-1-carboxamide is NC(=O)[C@@H]1C[C@@H]1F.
What is the InChIKey of cis-(1S,2S)-2-fluorocyclopropane-1-carboxamide?
The InChIKey is PHZKRDKMJHXGBR-GBXIJSLDSA-N. The full InChI is InChI=1S/C4H6FNO/c5-3-1-2(3)4(6)7/h2-3H,1H2,(H2,6,7)/t2-,3+/m1/s1.
What are the key properties of cis-(1S,2S)-2-fluorocyclopropane-1-carboxamide?
cis-(1S,2S)-2-fluorocyclopropane-1-carboxamide has a molecular weight of 103.10 g/mol, XLogP of -0.17, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2S)-2-fluorocyclopropane-1-carboxamide is sourced from PubChem (CID 67128653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).