About (3-amino-4-ethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) acetate
(3-amino-4-ethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) acetate (PubChem CID 67128960) has the molecular formula C12H16N2O2
and a molecular weight of 220.27 g/mol. Its IUPAC name is (3-amino-4-ethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) acetate.
Molecular Properties
| Compound Name | (3-amino-4-ethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) acetate |
| PubChem CID | 67128960 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | (3-amino-4-ethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) acetate |
| SMILES | CCc1c(N)cnc2c1CCC2OC(C)=O |
| InChI | InChI=1S/C12H16N2O2/c1-3-8-9-4-5-11(16-7(2)15)12(9)14-6-10(8)13/h6,11H,3-5,13H2,1-2H3 |
| InChIKey | SYJYPFCDNXZILJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-amino-4-ethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-4-ethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) acetate?
The IUPAC name of (3-amino-4-ethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) acetate (CID 67128960) is (3-amino-4-ethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) acetate.
What is the SMILES notation for (3-amino-4-ethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) acetate?
The canonical SMILES for (3-amino-4-ethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) acetate is CCc1c(N)cnc2c1CCC2OC(C)=O.
What is the InChIKey of (3-amino-4-ethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) acetate?
The InChIKey is SYJYPFCDNXZILJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2/c1-3-8-9-4-5-11(16-7(2)15)12(9)14-6-10(8)13/h6,11H,3-5,13H2,1-2H3.
What are the key properties of (3-amino-4-ethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) acetate?
(3-amino-4-ethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) acetate has a molecular weight of 220.27 g/mol, XLogP of 1.78, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-4-ethyl-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl) acetate is sourced from PubChem (CID 67128960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).