About CID 67129175
CID 67129175 (PubChem CID 67129175) has the molecular formula C27H24FN3NaO5
and a molecular weight of 512.49 g/mol.
Molecular Properties
| Compound Name | CID 67129175 |
| PubChem CID | 67129175 |
| Molecular Formula | C27H24FN3NaO5 |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | — |
| SMILES | CCOc1nc2ccc(F)cc2n1-c1cccc2c1OC[C@H]2Nc1ccc2c(c1)OC[C@H]2OC(C)=O.[Na] |
| InChI | InChI=1S/C27H24FN3O5.Na/c1-3-33-27-30-20-10-7-16(28)11-23(20)31(27)22-6-4-5-18-21(13-35-26(18)22)29-17-8-9-19-24(12-17)34-14-25(19)36-15(2)32;/h4-12,21,25,29H,3,13-14H2,1-2H3;/t21-,25-;/m1./s1 |
| InChIKey | FKZQIMBLHDWXIW-UPWLLONGSA-N |
| XLogP | 4.72 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze CID 67129175 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67129175?
The IUPAC name of CID 67129175 (CID 67129175) is not available.
What is the SMILES notation for CID 67129175?
The canonical SMILES for CID 67129175 is CCOc1nc2ccc(F)cc2n1-c1cccc2c1OC[C@H]2Nc1ccc2c(c1)OC[C@H]2OC(C)=O.[Na].
What is the InChIKey of CID 67129175?
The InChIKey is FKZQIMBLHDWXIW-UPWLLONGSA-N. The full InChI is InChI=1S/C27H24FN3O5.Na/c1-3-33-27-30-20-10-7-16(28)11-23(20)31(27)22-6-4-5-18-21(13-35-26(18)22)29-17-8-9-19-24(12-17)34-14-25(19)36-15(2)32;/h4-12,21,25,29H,3,13-14H2,1-2H3;/t21-,25-;/m1./s1.
What are the key properties of CID 67129175?
CID 67129175 has a molecular weight of 512.49 g/mol, XLogP of 4.72, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67129175 is sourced from PubChem (CID 67129175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).