About tetrazine-5-carboxamide
tetrazine-5-carboxamide (PubChem CID 67129373) has the molecular formula C3H3N5O
and a molecular weight of 125.09 g/mol. Its IUPAC name is tetrazine-5-carboxamide.
Molecular Properties
| Compound Name | tetrazine-5-carboxamide |
| PubChem CID | 67129373 |
| Molecular Formula | C3H3N5O |
| Molecular Weight | 125.09 g/mol |
| Exact Mass | 125.03 |
| IUPAC Name | tetrazine-5-carboxamide |
| SMILES | NC(=O)c1cnnnn1 |
| InChI | InChI=1S/C3H3N5O/c4-3(9)2-1-5-7-8-6-2/h1H,(H2,4,9) |
| InChIKey | KZPRSYXFRRKMGX-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.09 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tetrazine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrazine-5-carboxamide?
The IUPAC name of tetrazine-5-carboxamide (CID 67129373) is tetrazine-5-carboxamide.
What is the SMILES notation for tetrazine-5-carboxamide?
The canonical SMILES for tetrazine-5-carboxamide is NC(=O)c1cnnnn1.
What is the InChIKey of tetrazine-5-carboxamide?
The InChIKey is KZPRSYXFRRKMGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3N5O/c4-3(9)2-1-5-7-8-6-2/h1H,(H2,4,9).
What are the key properties of tetrazine-5-carboxamide?
tetrazine-5-carboxamide has a molecular weight of 125.09 g/mol, XLogP of -1.63, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tetrazine-5-carboxamide is sourced from PubChem (CID 67129373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).