C30H35F3N4O6 — CID 67129483
[6-[4-[4-(trifluoromethyl)piperazin-1-yl]benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-(4-methylpiperazin-1-yl)benzoate (PubChem CID 67129483) has the molecular formula C30H35F3N4O6 and a molecular weight of 604.63 g/mol. Its IUPAC name is [6-[4-[4-(trifluoromethyl)piperazin-1-yl]benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-(4-methylpiperazin-1-yl)benzoate.
| Compound Name | [6-[4-[4-(trifluoromethyl)piperazin-1-yl]benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-(4-methylpiperazin-1-yl)benzoate |
|---|---|
| PubChem CID | 67129483 |
| Molecular Formula | C30H35F3N4O6 |
| Molecular Weight | 604.63 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | [6-[4-[4-(trifluoromethyl)piperazin-1-yl]benzoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] 4-(4-methylpiperazin-1-yl)benzoate |
| SMILES | CN1CCN(c2ccc(C(=O)OC3COC4C(OC(=O)c5ccc(N6CCN(C(F)(F)F)CC6)cc5)COC34)cc2)CC1 |
| InChI | InChI=1S/C30H35F3N4O6/c1-34-10-12-35(13-11-34)22-6-2-20(3-7-22)28(38)42-24-18-40-27-25(19-41-26(24)27)43-29(39)21-4-8-23(9-5-21)36-14-16-37(17-15-36)30(31,32)33/h2-9,24-27H,10-19H2,1H3 |
| InChIKey | GGSGHXNGGPMSQC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 84.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.63 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|