C26H33F3N6O3S — CID 67129848
N-[[3-[(1R)-1-[3-(diethylamino)propylsulfonylamino]-3-phenylpropyl]-1H-1,2,4-triazol-5-yl]methyl]-2,4,5-trifluorobenzamide (PubChem CID 67129848) has the molecular formula C26H33F3N6O3S and a molecular weight of 566.65 g/mol. Its IUPAC name is N-[[3-[(1R)-1-[3-(diethylamino)propylsulfonylamino]-3-phenylpropyl]-1H-1,2,4-triazol-5-yl]methyl]-2,4,5-trifluorobenzamide.
| Compound Name | N-[[3-[(1R)-1-[3-(diethylamino)propylsulfonylamino]-3-phenylpropyl]-1H-1,2,4-triazol-5-yl]methyl]-2,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 67129848 |
| Molecular Formula | C26H33F3N6O3S |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | N-[[3-[(1R)-1-[3-(diethylamino)propylsulfonylamino]-3-phenylpropyl]-1H-1,2,4-triazol-5-yl]methyl]-2,4,5-trifluorobenzamide |
| SMILES | CCN(CC)CCCS(=O)(=O)N[C@H](CCc1ccccc1)c1n[nH]c(CNC(=O)c2cc(F)c(F)cc2F)n1 |
| InChI | InChI=1S/C26H33F3N6O3S/c1-3-35(4-2)13-8-14-39(37,38)34-23(12-11-18-9-6-5-7-10-18)25-31-24(32-33-25)17-30-26(36)19-15-21(28)22(29)16-20(19)27/h5-7,9-10,15-16,23,34H,3-4,8,11-14,17H2,1-2H3,(H,30,36)(H,31,32,33)/t23-/m1/s1 |
| InChIKey | VIHOIHUUBZLEKD-HSZRJFAPSA-N |
| XLogP | 3.48 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|