C16H17N7O — CID 67129963
4-N-(3-aminopropyl)-2-N-(1H-indazol-6-yl)furo[3,2-d]pyrimidine-2,4-diamine (PubChem CID 67129963) has the molecular formula C16H17N7O and a molecular weight of 323.36 g/mol. Its IUPAC name is 4-N-(3-aminopropyl)-2-N-(1H-indazol-6-yl)furo[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-aminopropyl)-2-N-(1H-indazol-6-yl)furo[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 67129963 |
| Molecular Formula | C16H17N7O |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 4-N-(3-aminopropyl)-2-N-(1H-indazol-6-yl)furo[3,2-d]pyrimidine-2,4-diamine |
| SMILES | NCCCNc1nc(Nc2ccc3cn[nH]c3c2)nc2ccoc12 |
| InChI | InChI=1S/C16H17N7O/c17-5-1-6-18-15-14-12(4-7-24-14)21-16(22-15)20-11-3-2-10-9-19-23-13(10)8-11/h2-4,7-9H,1,5-6,17H2,(H,19,23)(H2,18,20,21,22) |
| InChIKey | BGVCUANBSTWRDY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 117.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|