C20H32Cl2N6 — CID 67130282
2-[(1-amino-1-cyclohexa-1,5-dien-1-ylimino-2-methylpropan-2-yl)diazenyl]-N'-cyclohexa-1,5-dien-1-yl-2-methylpropanimidamide;dihydrochloride (PubChem CID 67130282) has the molecular formula C20H32Cl2N6 and a molecular weight of 427.42 g/mol. Its IUPAC name is 2-[(1-amino-1-cyclohexa-1,5-dien-1-ylimino-2-methylpropan-2-yl)diazenyl]-N'-cyclohexa-1,5-dien-1-yl-2-methylpropanimidamide;dihydrochloride.
| Compound Name | 2-[(1-amino-1-cyclohexa-1,5-dien-1-ylimino-2-methylpropan-2-yl)diazenyl]-N'-cyclohexa-1,5-dien-1-yl-2-methylpropanimidamide;dihydrochloride |
|---|---|
| PubChem CID | 67130282 |
| Molecular Formula | C20H32Cl2N6 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 2-[(1-amino-1-cyclohexa-1,5-dien-1-ylimino-2-methylpropan-2-yl)diazenyl]-N'-cyclohexa-1,5-dien-1-yl-2-methylpropanimidamide;dihydrochloride |
| SMILES | CC(C)(/N=N/C(C)(C)/C(N)=N/C1=CCCC=C1)/C(N)=N/C1=CCCC=C1.Cl.Cl |
| InChI | InChI=1S/C20H30N6.2ClH/c1-19(2,17(21)23-15-11-7-5-8-12-15)25-26-20(3,4)18(22)24-16-13-9-6-10-14-16;;/h7,9,11-14H,5-6,8,10H2,1-4H3,(H2,21,23)(H2,22,24);2*1H/b26-25+;; |
| InChIKey | KKMDJQLYMWTPQA-LHPVOXLHSA-N |
| XLogP | 5.02 |
| TPSA | 101.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|