About cyclopent-3-en-1-yl-[(1S,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone
cyclopent-3-en-1-yl-[(1S,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone (PubChem CID 67130729) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is cyclopent-3-en-1-yl-[(1S,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone.
Molecular Properties
| Compound Name | cyclopent-3-en-1-yl-[(1S,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone |
| PubChem CID | 67130729 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | cyclopent-3-en-1-yl-[(1S,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone |
| SMILES | O=C(C1CC=CC1)N1C[C@@H]2CN[C@@H](C2)C1 |
| InChI | InChI=1S/C12H18N2O/c15-12(10-3-1-2-4-10)14-7-9-5-11(8-14)13-6-9/h1-2,9-11,13H,3-8H2/t9-,11-/m0/s1 |
| InChIKey | JOYIUTFTOJKICT-ONGXEEELSA-N |
| XLogP | 0.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclopent-3-en-1-yl-[(1S,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopent-3-en-1-yl-[(1S,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone?
The IUPAC name of cyclopent-3-en-1-yl-[(1S,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone (CID 67130729) is cyclopent-3-en-1-yl-[(1S,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone.
What is the SMILES notation for cyclopent-3-en-1-yl-[(1S,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone?
The canonical SMILES for cyclopent-3-en-1-yl-[(1S,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone is O=C(C1CC=CC1)N1C[C@@H]2CN[C@@H](C2)C1.
What is the InChIKey of cyclopent-3-en-1-yl-[(1S,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone?
The InChIKey is JOYIUTFTOJKICT-ONGXEEELSA-N. The full InChI is InChI=1S/C12H18N2O/c15-12(10-3-1-2-4-10)14-7-9-5-11(8-14)13-6-9/h1-2,9-11,13H,3-8H2/t9-,11-/m0/s1.
What are the key properties of cyclopent-3-en-1-yl-[(1S,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone?
cyclopent-3-en-1-yl-[(1S,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone has a molecular weight of 206.29 g/mol, XLogP of 0.77, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopent-3-en-1-yl-[(1S,5S)-3,6-diazabicyclo[3.2.1]octan-3-yl]methanone is sourced from PubChem (CID 67130729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).