C27H20O7 — CID 6713083
(4S)-2-(1,3-benzodioxol-5-yl)-4-(3,4-dimethoxyphenyl)-4H-pyrano[3,2-c]chromen-5-one (PubChem CID 6713083) has the molecular formula C27H20O7 and a molecular weight of 456.45 g/mol. Its IUPAC name is (4S)-2-(1,3-benzodioxol-5-yl)-4-(3,4-dimethoxyphenyl)-4H-pyrano[3,2-c]chromen-5-one.
| Compound Name | (4S)-2-(1,3-benzodioxol-5-yl)-4-(3,4-dimethoxyphenyl)-4H-pyrano[3,2-c]chromen-5-one |
|---|---|
| PubChem CID | 6713083 |
| Molecular Formula | C27H20O7 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | (4S)-2-(1,3-benzodioxol-5-yl)-4-(3,4-dimethoxyphenyl)-4H-pyrano[3,2-c]chromen-5-one |
| SMILES | COc1ccc([C@@H]2C=C(c3ccc4c(c3)OCO4)Oc3c2c(=O)oc2ccccc32)cc1OC |
| InChI | InChI=1S/C27H20O7/c1-29-20-9-7-15(11-23(20)30-2)18-13-22(16-8-10-21-24(12-16)32-14-31-21)33-26-17-5-3-4-6-19(17)34-27(28)25(18)26/h3-13,18H,14H2,1-2H3/t18-/m0/s1 |
| InChIKey | AXGMPAAIRJSHFS-SFHVURJKSA-N |
| XLogP | 5.10 |
| TPSA | 76.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|