C7H9NO2 — CID 67130940
3a,4,5,6-tetrahydro-3H-1,3-benzoxazol-2-one (PubChem CID 67130940) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is 3a,4,5,6-tetrahydro-3H-1,3-benzoxazol-2-one.
| Compound Name | 3a,4,5,6-tetrahydro-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 67130940 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 3a,4,5,6-tetrahydro-3H-1,3-benzoxazol-2-one |
| SMILES | O=C1NC2CCCC=C2O1 |
| InChI | InChI=1S/C7H9NO2/c9-7-8-5-3-1-2-4-6(5)10-7/h4-5H,1-3H2,(H,8,9) |
| InChIKey | NSLUQDKRVZPWBI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |