C16H18FN3O3 — CID 67131228
tert-butyl N-[(5-fluoro-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl)methyl]carbamate (PubChem CID 67131228) has the molecular formula C16H18FN3O3 and a molecular weight of 319.34 g/mol. Its IUPAC name is tert-butyl N-[(5-fluoro-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(5-fluoro-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl)methyl]carbamate |
|---|---|
| PubChem CID | 67131228 |
| Molecular Formula | C16H18FN3O3 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | tert-butyl N-[(5-fluoro-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1Cn2c(=O)ccc3ncc(F)c1c32 |
| InChI | InChI=1S/C16H18FN3O3/c1-16(2,3)23-15(22)19-6-9-8-20-12(21)5-4-11-14(20)13(9)10(17)7-18-11/h4-5,7,9H,6,8H2,1-3H3,(H,19,22) |
| InChIKey | PXXKPIRDHDCZFY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |