About [azanidylmethyl(dimethyl)silyl]methylazanide;dichloroplatinum
[azanidylmethyl(dimethyl)silyl]methylazanide;dichloroplatinum (PubChem CID 6713139) has the molecular formula C4H12Cl2N2PtSi-2
and a molecular weight of 382.22 g/mol. Its IUPAC name is [azanidylmethyl(dimethyl)silyl]methylazanide;dichloroplatinum.
Molecular Properties
| Compound Name | [azanidylmethyl(dimethyl)silyl]methylazanide;dichloroplatinum |
| PubChem CID | 6713139 |
| Molecular Formula | C4H12Cl2N2PtSi-2 |
| Molecular Weight | 382.22 g/mol |
| Exact Mass | 380.98 |
| IUPAC Name | [azanidylmethyl(dimethyl)silyl]methylazanide;dichloroplatinum |
| SMILES | C[Si](C)(C[NH-])C[NH-].Cl[Pt]Cl |
| InChI | InChI=1S/C4H12N2Si.2ClH.Pt/c1-7(2,3-5)4-6;;;/h5-6H,3-4H2,1-2H3;2*1H;/q-2;;;+2/p-2 |
| InChIKey | ZNZMHKOOULCRAU-UHFFFAOYSA-L |
| XLogP | 3.25 |
| TPSA | 47.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.22 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [azanidylmethyl(dimethyl)silyl]methylazanide;dichloroplatinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [azanidylmethyl(dimethyl)silyl]methylazanide;dichloroplatinum?
The IUPAC name of [azanidylmethyl(dimethyl)silyl]methylazanide;dichloroplatinum (CID 6713139) is [azanidylmethyl(dimethyl)silyl]methylazanide;dichloroplatinum.
What is the SMILES notation for [azanidylmethyl(dimethyl)silyl]methylazanide;dichloroplatinum?
The canonical SMILES for [azanidylmethyl(dimethyl)silyl]methylazanide;dichloroplatinum is C[Si](C)(C[NH-])C[NH-].Cl[Pt]Cl.
What is the InChIKey of [azanidylmethyl(dimethyl)silyl]methylazanide;dichloroplatinum?
The InChIKey is ZNZMHKOOULCRAU-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H12N2Si.2ClH.Pt/c1-7(2,3-5)4-6;;;/h5-6H,3-4H2,1-2H3;2*1H;/q-2;;;+2/p-2.
What are the key properties of [azanidylmethyl(dimethyl)silyl]methylazanide;dichloroplatinum?
[azanidylmethyl(dimethyl)silyl]methylazanide;dichloroplatinum has a molecular weight of 382.22 g/mol, XLogP of 3.25, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [azanidylmethyl(dimethyl)silyl]methylazanide;dichloroplatinum is sourced from PubChem (CID 6713139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).