About 2-cyclohexyl-1,4-dihydroimidazol-5-one
2-cyclohexyl-1,4-dihydroimidazol-5-one (PubChem CID 67131672) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-cyclohexyl-1,4-dihydroimidazol-5-one.
Molecular Properties
| Compound Name | 2-cyclohexyl-1,4-dihydroimidazol-5-one |
| PubChem CID | 67131672 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 2-cyclohexyl-1,4-dihydroimidazol-5-one |
| SMILES | O=C1CN=C(C2CCCCC2)N1 |
| InChI | InChI=1S/C9H14N2O/c12-8-6-10-9(11-8)7-4-2-1-3-5-7/h7H,1-6H2,(H,10,11,12) |
| InChIKey | VUHMFLMYYWNGEC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclohexyl-1,4-dihydroimidazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-1,4-dihydroimidazol-5-one?
The IUPAC name of 2-cyclohexyl-1,4-dihydroimidazol-5-one (CID 67131672) is 2-cyclohexyl-1,4-dihydroimidazol-5-one.
What is the SMILES notation for 2-cyclohexyl-1,4-dihydroimidazol-5-one?
The canonical SMILES for 2-cyclohexyl-1,4-dihydroimidazol-5-one is O=C1CN=C(C2CCCCC2)N1.
What is the InChIKey of 2-cyclohexyl-1,4-dihydroimidazol-5-one?
The InChIKey is VUHMFLMYYWNGEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O/c12-8-6-10-9(11-8)7-4-2-1-3-5-7/h7H,1-6H2,(H,10,11,12).
What are the key properties of 2-cyclohexyl-1,4-dihydroimidazol-5-one?
2-cyclohexyl-1,4-dihydroimidazol-5-one has a molecular weight of 166.22 g/mol, XLogP of 1.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-1,4-dihydroimidazol-5-one is sourced from PubChem (CID 67131672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).