C25H35F2NO2Si — CID 67131675
(1S)-1-[(3R,4S)-1-benzyl-4-(3,4-difluorophenyl)pyrrolidin-3-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanol (PubChem CID 67131675) has the molecular formula C25H35F2NO2Si and a molecular weight of 447.64 g/mol. Its IUPAC name is (1S)-1-[(3R,4S)-1-benzyl-4-(3,4-difluorophenyl)pyrrolidin-3-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanol.
| Compound Name | (1S)-1-[(3R,4S)-1-benzyl-4-(3,4-difluorophenyl)pyrrolidin-3-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanol |
|---|---|
| PubChem CID | 67131675 |
| Molecular Formula | C25H35F2NO2Si |
| Molecular Weight | 447.64 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | (1S)-1-[(3R,4S)-1-benzyl-4-(3,4-difluorophenyl)pyrrolidin-3-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@H]1CN(Cc2ccccc2)C[C@@H]1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C25H35F2NO2Si/c1-25(2,3)31(4,5)30-17-24(29)21-16-28(14-18-9-7-6-8-10-18)15-20(21)19-11-12-22(26)23(27)13-19/h6-13,20-21,24,29H,14-17H2,1-5H3/t20-,21+,24-/m1/s1 |
| InChIKey | MGJUOLMWVHQMBL-ZFGGDYGUSA-N |
| XLogP | 5.56 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.64 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|