3,3-difluoro-1-hydroxycyclobutane-1-carboxylic acid

C5H6F2O3 — CID 67132432

IUPAC3,3-difluoro-1-hydroxycyclobutane-1-carboxylic acid
SMILESO=C(O)C1(O)CC(F)(F)C1
InChIInChI=1S/C5H6F2O3/c6-5(7)1-4(10,2-5)3(8)9/h10H,1-2H2,(H,8,9)
InChIKeyNYIZTUJIWYBWHZ-UHFFFAOYSA-N
MW152.10 g/mol
LogP0.23
Rot. Bonds1

About 3,3-difluoro-1-hydroxycyclobutane-1-carboxylic acid

3,3-difluoro-1-hydroxycyclobutane-1-carboxylic acid (PubChem CID 67132432) has the molecular formula C5H6F2O3 and a molecular weight of 152.10 g/mol. Its IUPAC name is 3,3-difluoro-1-hydroxycyclobutane-1-carboxylic acid.

Molecular Properties

Compound Name3,3-difluoro-1-hydroxycyclobutane-1-carboxylic acid
PubChem CID67132432
Molecular FormulaC5H6F2O3
Molecular Weight152.10 g/mol
Exact Mass152.03
IUPAC Name3,3-difluoro-1-hydroxycyclobutane-1-carboxylic acid
SMILESO=C(O)C1(O)CC(F)(F)C1
InChIInChI=1S/C5H6F2O3/c6-5(7)1-4(10,2-5)3(8)9/h10H,1-2H2,(H,8,9)
InChIKeyNYIZTUJIWYBWHZ-UHFFFAOYSA-N
XLogP0.23
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500152.10
LogP ≤ 50.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3,3-difluoro-1-hydroxycyclobutane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3-difluoro-1-hydroxycyclobutane-1-carboxylic acid?
The IUPAC name of 3,3-difluoro-1-hydroxycyclobutane-1-carboxylic acid (CID 67132432) is 3,3-difluoro-1-hydroxycyclobutane-1-carboxylic acid.
What is the SMILES notation for 3,3-difluoro-1-hydroxycyclobutane-1-carboxylic acid?
The canonical SMILES for 3,3-difluoro-1-hydroxycyclobutane-1-carboxylic acid is O=C(O)C1(O)CC(F)(F)C1.
What is the InChIKey of 3,3-difluoro-1-hydroxycyclobutane-1-carboxylic acid?
The InChIKey is NYIZTUJIWYBWHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6F2O3/c6-5(7)1-4(10,2-5)3(8)9/h10H,1-2H2,(H,8,9).
What are the key properties of 3,3-difluoro-1-hydroxycyclobutane-1-carboxylic acid?
3,3-difluoro-1-hydroxycyclobutane-1-carboxylic acid has a molecular weight of 152.10 g/mol, XLogP of 0.23, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-1-hydroxycyclobutane-1-carboxylic acid is sourced from PubChem (CID 67132432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).