About 3-propyl-5H-pyrrolo[3,2-d]pyrimidin-4-one
3-propyl-5H-pyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 67133301) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is 3-propyl-5H-pyrrolo[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-propyl-5H-pyrrolo[3,2-d]pyrimidin-4-one |
| PubChem CID | 67133301 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 3-propyl-5H-pyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | CCCn1cnc2cc[nH]c2c1=O |
| InChI | InChI=1S/C9H11N3O/c1-2-5-12-6-11-7-3-4-10-8(7)9(12)13/h3-4,6,10H,2,5H2,1H3 |
| InChIKey | AJUSSTKBXOHOIZ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-propyl-5H-pyrrolo[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propyl-5H-pyrrolo[3,2-d]pyrimidin-4-one?
The IUPAC name of 3-propyl-5H-pyrrolo[3,2-d]pyrimidin-4-one (CID 67133301) is 3-propyl-5H-pyrrolo[3,2-d]pyrimidin-4-one.
What is the SMILES notation for 3-propyl-5H-pyrrolo[3,2-d]pyrimidin-4-one?
The canonical SMILES for 3-propyl-5H-pyrrolo[3,2-d]pyrimidin-4-one is CCCn1cnc2cc[nH]c2c1=O.
What is the InChIKey of 3-propyl-5H-pyrrolo[3,2-d]pyrimidin-4-one?
The InChIKey is AJUSSTKBXOHOIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O/c1-2-5-12-6-11-7-3-4-10-8(7)9(12)13/h3-4,6,10H,2,5H2,1H3.
What are the key properties of 3-propyl-5H-pyrrolo[3,2-d]pyrimidin-4-one?
3-propyl-5H-pyrrolo[3,2-d]pyrimidin-4-one has a molecular weight of 177.21 g/mol, XLogP of 1.13, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propyl-5H-pyrrolo[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 67133301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).