About N,N-diethylpenta-1,3-dien-3-amine
N,N-diethylpenta-1,3-dien-3-amine (PubChem CID 6713340) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is N,N-diethylpenta-1,3-dien-3-amine.
Molecular Properties
| Compound Name | N,N-diethylpenta-1,3-dien-3-amine |
| PubChem CID | 6713340 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | N,N-diethylpenta-1,3-dien-3-amine |
| SMILES | C=CC(=CC)N(CC)CC |
| InChI | InChI=1S/C9H17N/c1-5-9(6-2)10(7-3)8-4/h5-6H,1,7-8H2,2-4H3 |
| InChIKey | VBRFQALENDNLPX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethylpenta-1,3-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylpenta-1,3-dien-3-amine?
The IUPAC name of N,N-diethylpenta-1,3-dien-3-amine (CID 6713340) is N,N-diethylpenta-1,3-dien-3-amine.
What is the SMILES notation for N,N-diethylpenta-1,3-dien-3-amine?
The canonical SMILES for N,N-diethylpenta-1,3-dien-3-amine is C=CC(=CC)N(CC)CC.
What is the InChIKey of N,N-diethylpenta-1,3-dien-3-amine?
The InChIKey is VBRFQALENDNLPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N/c1-5-9(6-2)10(7-3)8-4/h5-6H,1,7-8H2,2-4H3.
What are the key properties of N,N-diethylpenta-1,3-dien-3-amine?
N,N-diethylpenta-1,3-dien-3-amine has a molecular weight of 139.24 g/mol, XLogP of 2.42, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylpenta-1,3-dien-3-amine is sourced from PubChem (CID 6713340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).