C12H15NS — CID 67133605
2,3,4,4a,5a,6-hexahydro-1H-thiochromeno[3,2-b]pyridine (PubChem CID 67133605) has the molecular formula C12H15NS and a molecular weight of 205.33 g/mol. Its IUPAC name is 2,3,4,4a,5a,6-hexahydro-1H-thiochromeno[3,2-b]pyridine.
| Compound Name | 2,3,4,4a,5a,6-hexahydro-1H-thiochromeno[3,2-b]pyridine |
|---|---|
| PubChem CID | 67133605 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2,3,4,4a,5a,6-hexahydro-1H-thiochromeno[3,2-b]pyridine |
| SMILES | C1=CCC2SC3CCCNC3=CC2=C1 |
| InChI | InChI=1S/C12H15NS/c1-2-5-11-9(4-1)8-10-12(14-11)6-3-7-13-10/h1-2,4,8,11-13H,3,5-7H2 |
| InChIKey | BHPRFRLYEVZAGN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |