About benzo[g]isoindol-1-one
benzo[g]isoindol-1-one (PubChem CID 67133770) has the molecular formula C12H7NO
and a molecular weight of 181.19 g/mol. Its IUPAC name is benzo[g]isoindol-1-one.
Molecular Properties
| Compound Name | benzo[g]isoindol-1-one |
| PubChem CID | 67133770 |
| Molecular Formula | C12H7NO |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | benzo[g]isoindol-1-one |
| SMILES | O=C1N=Cc2ccc3ccccc3c21 |
| InChI | InChI=1S/C12H7NO/c14-12-11-9(7-13-12)6-5-8-3-1-2-4-10(8)11/h1-7H |
| InChIKey | CMJIEPZGWACMSV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzo[g]isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[g]isoindol-1-one?
The IUPAC name of benzo[g]isoindol-1-one (CID 67133770) is benzo[g]isoindol-1-one.
What is the SMILES notation for benzo[g]isoindol-1-one?
The canonical SMILES for benzo[g]isoindol-1-one is O=C1N=Cc2ccc3ccccc3c21.
What is the InChIKey of benzo[g]isoindol-1-one?
The InChIKey is CMJIEPZGWACMSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7NO/c14-12-11-9(7-13-12)6-5-8-3-1-2-4-10(8)11/h1-7H.
What are the key properties of benzo[g]isoindol-1-one?
benzo[g]isoindol-1-one has a molecular weight of 181.19 g/mol, XLogP of 2.41, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[g]isoindol-1-one is sourced from PubChem (CID 67133770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).