About N,N-dimethylpenta-1,3-dien-3-amine;propanedioic acid
N,N-dimethylpenta-1,3-dien-3-amine;propanedioic acid (PubChem CID 6713382) has the molecular formula C10H17NO4
and a molecular weight of 215.25 g/mol. Its IUPAC name is N,N-dimethylpenta-1,3-dien-3-amine;propanedioic acid.
Molecular Properties
| Compound Name | N,N-dimethylpenta-1,3-dien-3-amine;propanedioic acid |
| PubChem CID | 6713382 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | N,N-dimethylpenta-1,3-dien-3-amine;propanedioic acid |
| SMILES | C=CC(=CC)N(C)C.O=C(O)CC(=O)O |
| InChI | InChI=1S/C7H13N.C3H4O4/c1-5-7(6-2)8(3)4;4-2(5)1-3(6)7/h5-6H,1H2,2-4H3;1H2,(H,4,5)(H,6,7) |
| InChIKey | FOQSVUHSWBBTCR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylpenta-1,3-dien-3-amine;propanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylpenta-1,3-dien-3-amine;propanedioic acid?
The IUPAC name of N,N-dimethylpenta-1,3-dien-3-amine;propanedioic acid (CID 6713382) is N,N-dimethylpenta-1,3-dien-3-amine;propanedioic acid.
What is the SMILES notation for N,N-dimethylpenta-1,3-dien-3-amine;propanedioic acid?
The canonical SMILES for N,N-dimethylpenta-1,3-dien-3-amine;propanedioic acid is C=CC(=CC)N(C)C.O=C(O)CC(=O)O.
What is the InChIKey of N,N-dimethylpenta-1,3-dien-3-amine;propanedioic acid?
The InChIKey is FOQSVUHSWBBTCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N.C3H4O4/c1-5-7(6-2)8(3)4;4-2(5)1-3(6)7/h5-6H,1H2,2-4H3;1H2,(H,4,5)(H,6,7).
What are the key properties of N,N-dimethylpenta-1,3-dien-3-amine;propanedioic acid?
N,N-dimethylpenta-1,3-dien-3-amine;propanedioic acid has a molecular weight of 215.25 g/mol, XLogP of 1.18, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylpenta-1,3-dien-3-amine;propanedioic acid is sourced from PubChem (CID 6713382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).