About N'-[4-(3,5-dimethyl-1H-pyrazol-4-yl)butan-2-ylideneamino]methanediamine
N'-[4-(3,5-dimethyl-1H-pyrazol-4-yl)butan-2-ylideneamino]methanediamine (PubChem CID 6713398) has the molecular formula C10H19N5
and a molecular weight of 209.30 g/mol. Its IUPAC name is N'-[4-(3,5-dimethyl-1H-pyrazol-4-yl)butan-2-ylideneamino]methanediamine.
Molecular Properties
| Compound Name | N'-[4-(3,5-dimethyl-1H-pyrazol-4-yl)butan-2-ylideneamino]methanediamine |
| PubChem CID | 6713398 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | N'-[4-(3,5-dimethyl-1H-pyrazol-4-yl)butan-2-ylideneamino]methanediamine |
| SMILES | CC(CCc1c(C)n[nH]c1C)=NNCN |
| InChI | InChI=1S/C10H19N5/c1-7(13-12-6-11)4-5-10-8(2)14-15-9(10)3/h12H,4-6,11H2,1-3H3,(H,14,15) |
| InChIKey | PEJSKMTZOXBNAI-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[4-(3,5-dimethyl-1H-pyrazol-4-yl)butan-2-ylideneamino]methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[4-(3,5-dimethyl-1H-pyrazol-4-yl)butan-2-ylideneamino]methanediamine?
The IUPAC name of N'-[4-(3,5-dimethyl-1H-pyrazol-4-yl)butan-2-ylideneamino]methanediamine (CID 6713398) is N'-[4-(3,5-dimethyl-1H-pyrazol-4-yl)butan-2-ylideneamino]methanediamine.
What is the SMILES notation for N'-[4-(3,5-dimethyl-1H-pyrazol-4-yl)butan-2-ylideneamino]methanediamine?
The canonical SMILES for N'-[4-(3,5-dimethyl-1H-pyrazol-4-yl)butan-2-ylideneamino]methanediamine is CC(CCc1c(C)n[nH]c1C)=NNCN.
What is the InChIKey of N'-[4-(3,5-dimethyl-1H-pyrazol-4-yl)butan-2-ylideneamino]methanediamine?
The InChIKey is PEJSKMTZOXBNAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N5/c1-7(13-12-6-11)4-5-10-8(2)14-15-9(10)3/h12H,4-6,11H2,1-3H3,(H,14,15).
What are the key properties of N'-[4-(3,5-dimethyl-1H-pyrazol-4-yl)butan-2-ylideneamino]methanediamine?
N'-[4-(3,5-dimethyl-1H-pyrazol-4-yl)butan-2-ylideneamino]methanediamine has a molecular weight of 209.30 g/mol, XLogP of 0.84, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[4-(3,5-dimethyl-1H-pyrazol-4-yl)butan-2-ylideneamino]methanediamine is sourced from PubChem (CID 6713398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).