C16H18F3NO5S — CID 67134141
2-oxo-5-[2-[3-(trifluoromethyl)phenyl]sulfonylpropan-2-yl]piperidine-1-carboxylic acid (PubChem CID 67134141) has the molecular formula C16H18F3NO5S and a molecular weight of 393.38 g/mol. Its IUPAC name is 2-oxo-5-[2-[3-(trifluoromethyl)phenyl]sulfonylpropan-2-yl]piperidine-1-carboxylic acid.
| Compound Name | 2-oxo-5-[2-[3-(trifluoromethyl)phenyl]sulfonylpropan-2-yl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67134141 |
| Molecular Formula | C16H18F3NO5S |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 2-oxo-5-[2-[3-(trifluoromethyl)phenyl]sulfonylpropan-2-yl]piperidine-1-carboxylic acid |
| SMILES | CC(C)(C1CCC(=O)N(C(=O)O)C1)S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H18F3NO5S/c1-15(2,11-6-7-13(21)20(9-11)14(22)23)26(24,25)12-5-3-4-10(8-12)16(17,18)19/h3-5,8,11H,6-7,9H2,1-2H3,(H,22,23) |
| InChIKey | STJLVLAGHWSBNX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |