C21H21FN2O2S — CID 67134347
2-[3-(4-fluorophenyl)propylsulfanyl]-1-(pyridin-3-ylmethyl)-2H-pyridine-3-carboxylic acid (PubChem CID 67134347) has the molecular formula C21H21FN2O2S and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)propylsulfanyl]-1-(pyridin-3-ylmethyl)-2H-pyridine-3-carboxylic acid.
| Compound Name | 2-[3-(4-fluorophenyl)propylsulfanyl]-1-(pyridin-3-ylmethyl)-2H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 67134347 |
| Molecular Formula | C21H21FN2O2S |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 2-[3-(4-fluorophenyl)propylsulfanyl]-1-(pyridin-3-ylmethyl)-2H-pyridine-3-carboxylic acid |
| SMILES | O=C(O)C1=CC=CN(Cc2cccnc2)C1SCCCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H21FN2O2S/c22-18-9-7-16(8-10-18)5-3-13-27-20-19(21(25)26)6-2-12-24(20)15-17-4-1-11-23-14-17/h1-2,4,6-12,14,20H,3,5,13,15H2,(H,25,26) |
| InChIKey | YFTWILTZVAWNEK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|