About pent-4-en-2-amine
pent-4-en-2-amine (PubChem CID 6713451) has the molecular formula C5H11N
and a molecular weight of 85.15 g/mol. Its IUPAC name is pent-4-en-2-amine.
Molecular Properties
| Compound Name | pent-4-en-2-amine |
| PubChem CID | 6713451 |
| Molecular Formula | C5H11N |
| Molecular Weight | 85.15 g/mol |
| Exact Mass | 85.09 |
| IUPAC Name | pent-4-en-2-amine |
| SMILES | C=CCC(C)N |
| InChI | InChI=1S/C5H11N/c1-3-4-5(2)6/h3,5H,1,4,6H2,2H3 |
| InChIKey | BPIDLOWRIYHHBQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 85.15 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze pent-4-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-4-en-2-amine?
The IUPAC name of pent-4-en-2-amine (CID 6713451) is pent-4-en-2-amine.
What is the SMILES notation for pent-4-en-2-amine?
The canonical SMILES for pent-4-en-2-amine is C=CCC(C)N.
What is the InChIKey of pent-4-en-2-amine?
The InChIKey is BPIDLOWRIYHHBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N/c1-3-4-5(2)6/h3,5H,1,4,6H2,2H3.
What are the key properties of pent-4-en-2-amine?
pent-4-en-2-amine has a molecular weight of 85.15 g/mol, XLogP of 0.91, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pent-4-en-2-amine is sourced from PubChem (CID 6713451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).