About piperidine;trifluoromethanesulfonamide
piperidine;trifluoromethanesulfonamide (PubChem CID 67134795) has the molecular formula C6H13F3N2O2S
and a molecular weight of 234.24 g/mol. Its IUPAC name is piperidine;trifluoromethanesulfonamide.
Molecular Properties
| Compound Name | piperidine;trifluoromethanesulfonamide |
| PubChem CID | 67134795 |
| Molecular Formula | C6H13F3N2O2S |
| Molecular Weight | 234.24 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | piperidine;trifluoromethanesulfonamide |
| SMILES | C1CCNCC1.NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C5H11N.CH2F3NO2S/c1-2-4-6-5-3-1;2-1(3,4)8(5,6)7/h6H,1-5H2;(H2,5,6,7) |
| InChIKey | XPCXXSGAEUZDKI-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.24 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze piperidine;trifluoromethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidine;trifluoromethanesulfonamide?
The IUPAC name of piperidine;trifluoromethanesulfonamide (CID 67134795) is piperidine;trifluoromethanesulfonamide.
What is the SMILES notation for piperidine;trifluoromethanesulfonamide?
The canonical SMILES for piperidine;trifluoromethanesulfonamide is C1CCNCC1.NS(=O)(=O)C(F)(F)F.
What is the InChIKey of piperidine;trifluoromethanesulfonamide?
The InChIKey is XPCXXSGAEUZDKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N.CH2F3NO2S/c1-2-4-6-5-3-1;2-1(3,4)8(5,6)7/h6H,1-5H2;(H2,5,6,7).
What are the key properties of piperidine;trifluoromethanesulfonamide?
piperidine;trifluoromethanesulfonamide has a molecular weight of 234.24 g/mol, XLogP of 0.55, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine;trifluoromethanesulfonamide is sourced from PubChem (CID 67134795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).