C9H15N5O — CID 67134832
1,1,3,3-tetramethyl-2-(2-oxo-1H-pyrimidin-6-yl)guanidine (PubChem CID 67134832) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-(2-oxo-1H-pyrimidin-6-yl)guanidine.
| Compound Name | 1,1,3,3-tetramethyl-2-(2-oxo-1H-pyrimidin-6-yl)guanidine |
|---|---|
| PubChem CID | 67134832 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-(2-oxo-1H-pyrimidin-6-yl)guanidine |
| SMILES | CN(C)C(=Nc1ccnc(=O)[nH]1)N(C)C |
| InChI | InChI=1S/C9H15N5O/c1-13(2)9(14(3)4)12-7-5-6-10-8(15)11-7/h5-6H,1-4H3,(H,10,11,15) |
| InChIKey | RJFXFNZAHWATFY-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 64.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|