About benzhydrylbenzene;2H-chromene
benzhydrylbenzene;2H-chromene (PubChem CID 67134856) has the molecular formula C28H24O
and a molecular weight of 376.50 g/mol. Its IUPAC name is benzhydrylbenzene;2H-chromene.
Molecular Properties
| Compound Name | benzhydrylbenzene;2H-chromene |
| PubChem CID | 67134856 |
| Molecular Formula | C28H24O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | benzhydrylbenzene;2H-chromene |
| SMILES | C1=Cc2ccccc2OC1.c1ccc(C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H16.C9H8O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-6-9-8(4-1)5-3-7-10-9/h1-15,19H;1-6H,7H2 |
| InChIKey | CAIMTVCHYCTBOA-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze benzhydrylbenzene;2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzhydrylbenzene;2H-chromene?
The IUPAC name of benzhydrylbenzene;2H-chromene (CID 67134856) is benzhydrylbenzene;2H-chromene.
What is the SMILES notation for benzhydrylbenzene;2H-chromene?
The canonical SMILES for benzhydrylbenzene;2H-chromene is C1=Cc2ccccc2OC1.c1ccc(C(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of benzhydrylbenzene;2H-chromene?
The InChIKey is CAIMTVCHYCTBOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16.C9H8O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-6-9-8(4-1)5-3-7-10-9/h1-15,19H;1-6H,7H2.
What are the key properties of benzhydrylbenzene;2H-chromene?
benzhydrylbenzene;2H-chromene has a molecular weight of 376.50 g/mol, XLogP of 6.96, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzhydrylbenzene;2H-chromene is sourced from PubChem (CID 67134856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).