C38H42F2N4O8S2 — CID 67134886
2,2-bis[2-[(4-benzylsulfonylpiperazin-1-yl)methyl]-4-fluorophenoxy]acetic acid (PubChem CID 67134886) has the molecular formula C38H42F2N4O8S2 and a molecular weight of 784.90 g/mol. Its IUPAC name is 2,2-bis[2-[(4-benzylsulfonylpiperazin-1-yl)methyl]-4-fluorophenoxy]acetic acid.
| Compound Name | 2,2-bis[2-[(4-benzylsulfonylpiperazin-1-yl)methyl]-4-fluorophenoxy]acetic acid |
|---|---|
| PubChem CID | 67134886 |
| Molecular Formula | C38H42F2N4O8S2 |
| Molecular Weight | 784.90 g/mol |
| Exact Mass | 784.24 |
| IUPAC Name | 2,2-bis[2-[(4-benzylsulfonylpiperazin-1-yl)methyl]-4-fluorophenoxy]acetic acid |
| SMILES | O=C(O)C(Oc1ccc(F)cc1CN1CCN(S(=O)(=O)Cc2ccccc2)CC1)Oc1ccc(F)cc1CN1CCN(S(=O)(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C38H42F2N4O8S2/c39-33-11-13-35(31(23-33)25-41-15-19-43(20-16-41)53(47,48)27-29-7-3-1-4-8-29)51-38(37(45)46)52-36-14-12-34(40)24-32(36)26-42-17-21-44(22-18-42)54(49,50)28-30-9-5-2-6-10-30/h1-14,23-24,38H,15-22,25-28H2,(H,45,46) |
| InChIKey | JILSWEXUWQSZGW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 137.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.90 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|