C26H25N7 — CID 67135306
N-(1H-indazol-5-yl)-2-[3-(4-methylpiperazin-1-yl)phenyl]quinazolin-4-amine (PubChem CID 67135306) has the molecular formula C26H25N7 and a molecular weight of 435.54 g/mol. Its IUPAC name is N-(1H-indazol-5-yl)-2-[3-(4-methylpiperazin-1-yl)phenyl]quinazolin-4-amine.
| Compound Name | N-(1H-indazol-5-yl)-2-[3-(4-methylpiperazin-1-yl)phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 67135306 |
| Molecular Formula | C26H25N7 |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | N-(1H-indazol-5-yl)-2-[3-(4-methylpiperazin-1-yl)phenyl]quinazolin-4-amine |
| SMILES | CN1CCN(c2cccc(-c3nc(Nc4ccc5[nH]ncc5c4)c4ccccc4n3)c2)CC1 |
| InChI | InChI=1S/C26H25N7/c1-32-11-13-33(14-12-32)21-6-4-5-18(16-21)25-29-24-8-3-2-7-22(24)26(30-25)28-20-9-10-23-19(15-20)17-27-31-23/h2-10,15-17H,11-14H2,1H3,(H,27,31)(H,28,29,30) |
| InChIKey | UHBQRXBZQZGIPQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |