C17H10F5N3O3 — CID 67135491
5-(2,6-difluoro-4-nitrophenoxy)-1,3-dimethyl-4-(2,4,6-trifluorophenyl)pyrazole (PubChem CID 67135491) has the molecular formula C17H10F5N3O3 and a molecular weight of 399.28 g/mol. Its IUPAC name is 5-(2,6-difluoro-4-nitrophenoxy)-1,3-dimethyl-4-(2,4,6-trifluorophenyl)pyrazole.
| Compound Name | 5-(2,6-difluoro-4-nitrophenoxy)-1,3-dimethyl-4-(2,4,6-trifluorophenyl)pyrazole |
|---|---|
| PubChem CID | 67135491 |
| Molecular Formula | C17H10F5N3O3 |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 5-(2,6-difluoro-4-nitrophenoxy)-1,3-dimethyl-4-(2,4,6-trifluorophenyl)pyrazole |
| SMILES | Cc1nn(C)c(Oc2c(F)cc([N+](=O)[O-])cc2F)c1-c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C17H10F5N3O3/c1-7-14(15-10(19)3-8(18)4-11(15)20)17(24(2)23-7)28-16-12(21)5-9(25(26)27)6-13(16)22/h3-6H,1-2H3 |
| InChIKey | XJNIRFNNDIZARX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|