C25H28ClN5O4S — CID 67135513
7-(1,3-dihydroisoindole-2-carbonyl)-1-[(1,1-dihydroxythian-4-yl)methyl]-8-methyl-5H-[1,2,4]triazolo[4,3-a]quinoxalin-4-one;hydrochloride (PubChem CID 67135513) has the molecular formula C25H28ClN5O4S and a molecular weight of 530.05 g/mol. Its IUPAC name is 7-(1,3-dihydroisoindole-2-carbonyl)-1-[(1,1-dihydroxythian-4-yl)methyl]-8-methyl-5H-[1,2,4]triazolo[4,3-a]quinoxalin-4-one;hydrochloride.
| Compound Name | 7-(1,3-dihydroisoindole-2-carbonyl)-1-[(1,1-dihydroxythian-4-yl)methyl]-8-methyl-5H-[1,2,4]triazolo[4,3-a]quinoxalin-4-one;hydrochloride |
|---|---|
| PubChem CID | 67135513 |
| Molecular Formula | C25H28ClN5O4S |
| Molecular Weight | 530.05 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | 7-(1,3-dihydroisoindole-2-carbonyl)-1-[(1,1-dihydroxythian-4-yl)methyl]-8-methyl-5H-[1,2,4]triazolo[4,3-a]quinoxalin-4-one;hydrochloride |
| SMILES | Cc1cc2c(cc1C(=O)N1Cc3ccccc3C1)[nH]c(=O)c1nnc(CC3CCS(O)(O)CC3)n12.Cl |
| InChI | InChI=1S/C25H27N5O4S.ClH/c1-15-10-21-20(12-19(15)25(32)29-13-17-4-2-3-5-18(17)14-29)26-24(31)23-28-27-22(30(21)23)11-16-6-8-35(33,34)9-7-16;/h2-5,10,12,16,33-34H,6-9,11,13-14H2,1H3,(H,26,31);1H |
| InChIKey | JTIQXGIPSFZAGB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 123.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.05 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |